3-Methyl-2-piperazinone
Catalog No: FT-0677567
CAS No: 23936-11-0
- Chemical Name: 3-Methyl-2-piperazinone
- Molecular Formula: C5H10N2O
- Molecular Weight: 114.15
- InChI Key: BSPUWRUTIOUGMZ-UHFFFAOYSA-N
- InChI: InChI=1S/C5H10N2O/c1-4-5(8)7-3-2-6-4/h4,6H,2-3H2,1H3,(H,7,8)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 114.14600 |
| Density: | 0.992g/cm3 |
| CAS: | 23936-11-0 |
| Bolling_Point: | 289.6ºC at 760 mmHg |
| Product_Name: | 3-methylpiperazin-2-one |
| Melting_Point: | N/A |
| Flash_Point: | 148.7ºC |
| MF: | C5H10N2O |
| Density: | 0.992g/cm3 |
|---|---|
| Flash_Point: | 148.7ºC |
| Refractive_Index: | 1.434 |
| FW: | 114.14600 |
| PSA: | 41.13000 |
| MF: | C5H10N2O |
| Bolling_Point: | 289.6ºC at 760 mmHg |
| Vapor_Pressure: | 0.00217mmHg at 25°C |
| Exact_Mass: | 114.07900 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338-P342 + P311 |
| Safety_Statements: | H319-H334 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)